76981-87-8 Usage
General Description
The chemical 2-(2-chloro-acetylamino)-6-methyl-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid ethyl ester is an organic compound with a complex structure. It contains a chloro-acetylamino group, a methyl group, and a carboxylic acid ethyl ester group. The presence of a benzothiophene ring in its structure makes it a potentially valuable compound in pharmaceutical research, as benzothiophenes are known for their pharmacological activities such as antiviral, antimicrobial, and anticancer properties. This chemical may have applications in the development of new pharmaceuticals or agrochemicals due to its unique structure and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 76981-87-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,9,8 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 76981-87:
(7*7)+(6*6)+(5*9)+(4*8)+(3*1)+(2*8)+(1*7)=188
188 % 10 = 8
So 76981-87-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H18ClNO3S/c1-3-19-14(18)12-9-5-4-8(2)6-10(9)20-13(12)16-11(17)7-15/h8H,3-7H2,1-2H3,(H,16,17)/t8-/m1/s1
