774608-89-8 Usage
General Description
5-Bromo-1H-1,2,4-triazole-3-carboxylic acid ethyl ester is a chemical compound that belongs to the class of 1,2,4-triazole derivatives. It is an ester derivative of 5-bromo-1H-1,2,4-triazole-3-carboxylic acid and is commonly used in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. This chemical is known for its versatile reactivity and is often used as a building block in the production of various heterocyclic compounds. Its unique structure and functional groups make it a valuable intermediate in the development of new drugs and other chemical products. It is also widely used in research laboratories as a reagent for various organic synthesis reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 774608-89-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,4,6,0 and 8 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 774608-89:
(8*7)+(7*7)+(6*4)+(5*6)+(4*0)+(3*8)+(2*8)+(1*9)=208
208 % 10 = 8
So 774608-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H6BrN3O2/c1-2-11-4(10)3-7-5(6)9-8-3/h2H2,1H3,(H,7,8,9)