77471-44-4 Usage
Description
4-METHYLUMBELLIFERYL ALPHA-L-ARABINOFURANOSIDE, with the CAS number 77471-44-4, is a white to off-white powdery compound that is primarily utilized in organic synthesis. It is a derivative of umbelliferone, a naturally occurring compound found in various plants, and is known for its unique chemical properties that make it a valuable component in the synthesis of various organic compounds.
Uses
Used in Organic Synthesis:
4-METHYLUMBELLIFERYL ALPHA-L-ARABINOFURANOSIDE is used as a synthetic intermediate for the production of various organic compounds. Its unique chemical structure allows it to be a versatile building block in the synthesis of a wide range of molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Research and Development:
In the field of research and development, 4-METHYLUMBELLIFERYL ALPHA-L-ARABINOFURANOSIDE is employed as a research tool to study the properties and reactivity of various organic compounds. Its use in this context helps scientists gain a deeper understanding of the underlying chemical reactions and mechanisms, which can ultimately lead to the development of new and innovative products.
Used in Pharmaceutical Industry:
4-METHYLUMBELLIFERYL ALPHA-L-ARABINOFURANOSIDE is used as a key component in the development of new drugs and pharmaceuticals. Its unique chemical properties make it an attractive candidate for the synthesis of novel drug molecules, which can potentially be used to treat various diseases and medical conditions.
Used in Analytical Chemistry:
In the field of analytical chemistry, 4-METHYLUMBELLIFERYL ALPHA-L-ARABINOFURANOSIDE is utilized as a reagent for the detection and quantification of specific enzymes, such as glycosidases. Its use in this context allows for the accurate measurement of enzyme activity, which can be crucial in the diagnosis and monitoring of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 77471-44-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,4,7 and 1 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 77471-44:
(7*7)+(6*7)+(5*4)+(4*7)+(3*1)+(2*4)+(1*4)=154
154 % 10 = 4
So 77471-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H16O7/c1-7-4-12(17)21-10-5-8(2-3-9(7)10)20-15-14(19)13(18)11(6-16)22-15/h2-5,11,13-16,18-19H,6H2,1H3/t11-,13+,14-,15-/m0/s1
77471-44-4Relevant articles and documents
Synthesis of 4-methylcoumarin-7-yl β-D-galactofuranoside, a fluorogenic substrate for galactofuranosidase
Marino, Carla,Cancio, Maria J.,Varela, Oscar,Lederkremer, Rosa M. de
, p. 209 - 214 (2007/10/03)
Keywords: 4-Methylcoumarin-7-yl β-D-galactofuranoside; Fluorogenic substrate; Galactofuranosidase
