78859-36-6 Usage
Description
4-AMINO-6-METHYL-2,5,10,10B-TETRAAZAFLUORANTHENE is a heterocyclic aromatic amine compound with a unique molecular structure that features a fluoranthene core, an amino group at the 4-position, and a methyl group at the 6-position. 4-AMINO-6-METHYL-2,5,10,10B-TETRAAZAFLUORANTHENE is of interest in the field of chemistry and biology due to its potential applications and properties.
Uses
Used in Biological Studies:
4-AMINO-6-METHYL-2,5,10,10B-TETRAAZAFLUORANTHENE is used as a subject in density functional studies for investigating the relationship between the molecular structure and the carcinogenicity or mutagenicity of heterocyclic aromatic amines. This research is crucial for understanding the potential health risks associated with exposure to such compounds and for developing strategies to mitigate their harmful effects.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, compounds with similar structures to 4-AMINO-6-METHYL-2,5,10,10B-TETRAAZAFLUORANTHENE may have potential applications in the pharmaceutical industry. They could be used as starting materials for the synthesis of new drugs or as active pharmaceutical ingredients themselves, targeting specific biological pathways or receptors.
Used in Chemical Research:
4-AMINO-6-METHYL-2,5,10,10B-TETRAAZAFLUORANTHENE can be utilized in chemical research to explore its reactivity, stability, and potential use in the synthesis of other complex organic molecules. Understanding its chemical properties can lead to the development of new synthetic routes and applications in various fields.
Used in Environmental Studies:
Given its potential carcinogenic or mutagenic properties, 4-AMINO-6-METHYL-2,5,10,10B-TETRAAZAFLUORANTHENE may also be relevant in environmental studies. It can be used to assess the presence of such compounds in the environment, their impact on ecosystems, and the development of methods for their detection and removal.
Check Digit Verification of cas no
The CAS Registry Mumber 78859-36-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,8,5 and 9 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 78859-36:
(7*7)+(6*8)+(5*8)+(4*5)+(3*9)+(2*3)+(1*6)=196
196 % 10 = 6
So 78859-36-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N5/c1-7-10-8-3-2-4-16-13(8)18-6-15-5-9(11(10)18)12(14)17-7/h2-5H,6H2,1H3,(H2,14,17)