78880-63-4 Usage
Class of compounds
Dibenzazepine This refers to the general class of chemical compounds that 10-nitro-5H-dibenz[b,f]azepine-5-carbonitrile belongs to, characterized by a specific fused-ring structure.
Nitro group
Presence of -NO2 The nitro group is a functional group consisting of an oxygen-nitrogen-oxygen structure (-ONO2) that can act as a strong electron-withdrawing group, influencing the reactivity and properties of the compound.
Cyano group
Presence of -CN The cyano group is a functional group consisting of a carbon-nitrogen triple bond (-CN) that is highly polar and can also act as an electron-withdrawing group, affecting the compound's reactivity and properties.
Synthesis of pharmaceutical and agrochemical compounds
Versatile reactivity and biological activity The compound's unique structure and reactivity make it a valuable building block in the synthesis of various pharmaceutical and agrochemical products, contributing to the development of new drugs and pest control agents.
Important intermediate
Production of functional molecules Due to its structure and properties, 10-nitro-5H-dibenz[b,f]azepine-5-carbonitrile serves as a crucial intermediate in the synthesis of a wide range of functional molecules, which can be further modified or used as precursors in various chemical reactions.
Potential applications
Medicinal chemistry and material science The compound's unique structure and properties make it an interesting target for further research and exploration in the fields of medicinal chemistry and material science, potentially leading to the development of new therapeutic agents or advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 78880-63-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,8,8 and 0 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 78880-63:
(7*7)+(6*8)+(5*8)+(4*8)+(3*0)+(2*6)+(1*3)=184
184 % 10 = 4
So 78880-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H9N3O2/c16-10-17-13-7-3-1-5-11(13)9-15(18(19)20)12-6-2-4-8-14(12)17/h1-9H
78880-63-4Relevant articles and documents
Process for the manufacture of 5-carbamoyl-10-oxo-10,11-dihydro-5H-dibenz[b,]azepine
-
, (2008/06/13)
The invention relates to a process for the manufacture of the known 5-carbamoyl-10-oxo-10,11-dihydro-5H-dibenz[b,f]azepine of the formula III which is characterized in that, for example, 5-cyano-5H-dibenz[b,f]azepine of the formula I is nitrated to form 5-cyano-10-nitro-5H-dibenz[b,f]azepine of the formula II, this is subjected to hydrolysis, then reduction, then the reduction product contained in the reaction mixture is subjected to hydrolysis and the end product of the formula III is isolated in pure form. The process is illustrated by the following reaction scheme: STR1 The invention relates also to new intermediates produced in these reactions.
