80377-39-5 Usage
Description
[(2R,3R,4S,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxy-phenyl)ethoxy]-2-(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2-yl]oxy-oxan-3-yl] (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate is a complex organic molecule characterized by its multiple hydroxyl, methoxy, and oxan groups. It features a hydroxy-6-[2-(3-hydroxy-4-methoxy-phenyl)ethoxy] moiety and an (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate group. [(2R,3R,4S,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxy-phenyl)ethoxy]-2 -(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2yl]oxy-oxan-3-yl] (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate's structure suggests potential biological or pharmaceutical relevance, possibly as a natural product or a synthetic compound with specific biological activities. Its precise function and properties would depend on its specific stereochemistry and the context in which it is used or studied.
Uses
Used in Pharmaceutical Industry:
[(2R,3R,4S,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxy-phenyl)ethoxy]-2-(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2-yl]oxy-oxan-3-yl] (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate is used as a potential therapeutic agent for various applications due to its complex structure and multiple functional groups that may interact with biological targets.
Used in Chemical Research:
[(2R,3R,4S,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxy-phenyl)ethoxy]-2 -(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2yl]oxy-oxan-3-yl] (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate is used as a subject of study in chemical research to understand its reactivity, stability, and potential applications in the synthesis of other complex organic molecules or as a model for understanding the behavior of similar structures in biological systems.
Used in Material Science:
[(2R,3R,4S,5R,6R)-5-hydroxy-6-[2-(3-hydroxy-4-methoxy-phenyl)ethoxy]-2 -(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyl-oxan-2yl]oxy-oxan-3-yl] (E)-3-(3-hydroxy-4-methoxy-phenyl)prop-2-enoate's unique structure may also find applications in material science, potentially serving as a component in the development of new materials with specific properties, such as improved solubility, reactivity, or biocompatibility.
Please note that without specific information on the compound's biological activities or its applications in various industries, the uses listed above are speculative based on the compound's structural features and potential for interaction with biological systems. Further research and experimentation would be required to confirm these potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 80377-39-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,3,7 and 7 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 80377-39:
(7*8)+(6*0)+(5*3)+(4*7)+(3*7)+(2*3)+(1*9)=135
135 % 10 = 5
So 80377-39-5 is a valid CAS Registry Number.
InChI:InChI=1/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-21(41-3)19(34)13-17)44-22(14-32)28(29)45-23(35)9-6-16-4-7-20(40-2)18(33)12-16/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3/b9-6+/t15-,22+,24-,25+,26+,27+,28+,29+,30+,31-/m0/s1