81-59-4 Usage
Description
2,3-dihydro-1,4,5,8-tetrahydroxyanthraquinone is a chemical compound with a unique molecular structure that features a central anthraquinone ring and four hydroxyl groups attached at positions 1, 4, 5, and 8. 2,3-dihydro-1,4,5,8-tetrahydroxyanthraquinone is known for its potential applications in various fields, particularly in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
2,3-dihydro-1,4,5,8-tetrahydroxyanthraquinone is used as a reactant for the preparation of chloroethylaminoethylaminoanthraquinones, which exhibit potent cytotoxicity against cisplatin-resistant tumor cells. This makes it a valuable compound in the development of novel anticancer agents that can overcome drug resistance in cancer treatment.
Used in Chemical Industry:
2,3-dihydro-1,4,5,8-tetrahydroxyanthraquinone can also be utilized as an intermediate in the synthesis of various chemical compounds and dyes. Its unique structure and functional groups make it a versatile building block for creating a wide range of products with different properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 81-59-4 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 81-59:
(4*8)+(3*1)+(2*5)+(1*9)=54
54 % 10 = 4
So 81-59-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H10O6/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-2,15-18H,3-4H2