816456-44-7 Usage
Description
4-(2-Hydroxyethyl)-N-ethyl-piperazine-1-carboxylamide is a chemical compound with the molecular formula C11H22N4O2. It is a derivative of piperazine and contains a carboxylic acid and an amide functional group. 4-(2-HYDROXYETHYL)-N-ETHYL-PIPERAZINE-1-CARBOXYLAMIDE has potential pharmaceutical applications due to its structure and properties. It may act as a building block for the synthesis of new drugs or as a pharmacophore for the development of novel pharmaceutical agents. Its chemical structure suggests that it may have biological activity and could be further investigated for its potential therapeutic effects.
Uses
Used in Pharmaceutical Industry:
4-(2-Hydroxyethyl)-N-ethyl-piperazine-1-carboxylamide is used as a building block for the synthesis of new drugs. Its unique structure and functional groups make it a promising candidate for the development of novel pharmaceutical agents.
Used in Drug Discovery:
4-(2-Hydroxyethyl)-N-ethyl-piperazine-1-carboxylamide is used as a pharmacophore for the development of novel pharmaceutical agents. Its chemical structure suggests that it may have biological activity, making it a valuable starting point for further research and development in the field of drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 816456-44-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,1,6,4,5 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 816456-44:
(8*8)+(7*1)+(6*6)+(5*4)+(4*5)+(3*6)+(2*4)+(1*4)=177
177 % 10 = 7
So 816456-44-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H19N3O2/c1-2-10-9(14)12-5-3-11(4-6-12)7-8-13/h13H,2-8H2,1H3,(H,10,14)