817186-93-9 Usage
Description
4-(4-Chlorophenoxy)piperidine hydrochloride is an organic compound that serves as an intermediate in the synthesis of various pharmaceuticals. It is characterized by the presence of a chlorophenoxy group attached to a piperidine ring, which contributes to its chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
4-(4-Chlorophenoxy)piperidine hydrochloride is used as a key intermediate in the preparation of pyrrolopyrimidine A2b selective antagonist compounds. These compounds have potential therapeutic applications, particularly in the development of drugs targeting adenosine receptors, which play a crucial role in various physiological processes and disease conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 817186-93-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,1,7,1,8 and 6 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 817186-93:
(8*8)+(7*1)+(6*7)+(5*1)+(4*8)+(3*6)+(2*9)+(1*3)=189
189 % 10 = 9
So 817186-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H13Cl2NO/c12-10-2-1-9(7-11(10)13)15-8-3-5-14-6-4-8/h1-2,7-8,14H,3-6H2