822-63-9 Usage
Description
5-AMINO-2,3-DIHYDRO-1,2-OXAZOL-3-ONE is a heterocyclic chemical compound with the molecular formula C3H4N2O2. It features a five-membered ring structure that includes an oxygen atom and a nitrogen atom. 5-AMINO-2,3-DIHYDRO-1,2-OXAZOL-3-ONE is recognized for its potential as a building block in the development of new drugs and has demonstrated promise in treating a range of diseases and medical conditions. Its applications extend to medicinal chemistry and drug discovery, with the compound also exhibiting antimicrobial and antioxidant properties, highlighting its versatility and value across different fields.
Uses
Used in Pharmaceutical Synthesis:
5-AMINO-2,3-DIHYDRO-1,2-OXAZOL-3-ONE serves as an intermediate in the synthesis of various pharmaceuticals and organic compounds. Its unique structure allows it to be a key component in creating new medications, contributing to advancements in healthcare and medicine.
Used in Medicinal Chemistry and Drug Discovery:
In the fields of medicinal chemistry and drug discovery, 5-AMINO-2,3-DIHYDRO-1,2-OXAZOL-3-ONE is utilized for its potential to contribute to the development of novel therapeutic agents. Its presence in experimental and research settings aids scientists in understanding its properties and how it can be harnessed to combat diseases and improve patient outcomes.
Used in Antimicrobial Applications:
5-AMINO-2,3-DIHYDRO-1,2-OXAZOL-3-ONE has been found to possess antimicrobial properties, making it a valuable compound in the development of new antimicrobial agents. This can be particularly useful in addressing the growing concern of antibiotic resistance and the need for new treatments to combat various infections.
Used in Antioxidant Formulations:
The antioxidant properties of 5-AMINO-2,3-DIHYDRO-1,2-OXAZOL-3-ONE also make it a candidate for use in antioxidant formulations. This can be beneficial in various industries, such as cosmetics, food and beverage, and healthcare, where antioxidants are used to prevent oxidative damage and extend the shelf life or maintain the quality of products.
Check Digit Verification of cas no
The CAS Registry Mumber 822-63-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,2 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 822-63:
(5*8)+(4*2)+(3*2)+(2*6)+(1*3)=69
69 % 10 = 9
So 822-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H4N2O2/c4-2-1-3(6)5-7-2/h1H,4H2,(H,5,6)