830-73-9 Usage
Description
(E)-(phenyl-thiophen-2-yl-methylidene)hydrazine, also known as PTMH, is a chemical compound characterized by its molecular formula C9H8N2S. It is a hydrazine derivative featuring a thiophene ring and a phenyl group, which contributes to its unique chemical properties and potential applications.
Uses
Used in Pharmaceutical Industry:
(E)-(phenyl-thiophen-2-yl-methylidene)hydrazine is used as a precursor in the synthesis of various bioactive compounds, making it a crucial component in the development of new pharmaceuticals.
Used in Organic Synthesis:
PTMH is utilized as a reagent in organic synthesis, where its unique structure allows for the creation of new molecules with potential applications in different fields.
Used in Medicinal Chemistry:
(E)-(phenyl-thiophen-2-yl-methylidene)hydrazine is used as a building block in the development of new molecules with potential medicinal properties, thanks to its versatile chemical structure.
Used in Antitumor Research:
PTMH has been studied for its potential antitumor properties, indicating its importance in the field of medicinal chemistry and the development of novel cancer treatments.
Used in Antimicrobial Applications:
Additionally, (E)-(phenyl-thiophen-2-yl-methylidene)hydrazine has shown promise in antimicrobial research, suggesting its potential use in the development of new antibiotics or antifungal agents.
Check Digit Verification of cas no
The CAS Registry Mumber 830-73-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,3 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 830-73:
(5*8)+(4*3)+(3*0)+(2*7)+(1*3)=69
69 % 10 = 9
So 830-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2S/c12-13-11(10-7-4-8-14-10)9-5-2-1-3-6-9/h1-8H,12H2/b13-11+
