833472-82-5 Usage
Description
METHYL 3-(3-BORONOPHENYL)PROPIONATE is an organic compound that features a boron-containing phenyl group attached to a propionate ester. This unique structure endows it with potential applications in various fields, particularly in medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Industry:
METHYL 3-(3-BORONOPHENYL)PROPIONATE is used as a key intermediate in the synthesis of ethylenediamine inhibitors to protein farnesyltransferase. These inhibitors are crucial for the development of antimalarial and anticancer drugs, as they target the enzyme responsible for protein prenylation, a critical process in the life cycle of malaria parasites and cancer cells.
In the context of antimalarial applications, METHYL 3-(3-BORONOPHENYL)PROPIONATE contributes to the creation of drugs that can effectively combat malaria by inhibiting the farnesyltransferase enzyme, which is essential for the survival and replication of the Plasmodium parasite.
For anticancer applications, METHYL 3-(3-BORONOPHENYL)PROPIONATE plays a significant role in the development of drugs that can impede the growth and proliferation of cancer cells. By inhibiting protein farnesyltransferase, these drugs can disrupt the signaling pathways that promote cell division and survival in cancer cells, thereby offering a potential therapeutic strategy against various types of cancer.
Overall, METHYL 3-(3-BORONOPHENYL)PROPIONATE is a valuable compound in the pharmaceutical industry due to its role in the synthesis of ethylenediamine inhibitors, which have potential applications in the treatment of malaria and cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 833472-82-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,3,4,7 and 2 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 833472-82:
(8*8)+(7*3)+(6*3)+(5*4)+(4*7)+(3*2)+(2*8)+(1*2)=175
175 % 10 = 5
So 833472-82-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BO4/c1-15-10(12)6-5-8-3-2-4-9(7-8)11(13)14/h2-4,7,13-14H,5-6H2,1H3
833472-82-5Relevant articles and documents
MACROCYCLIC FACTOR VIIA INHIBITORS
-
, (2015/01/09)
The present invention provides compounds of Formula (I) as defined in the specification and compositions comprising any of such novel compounds. These compounds are Factor VIIa inhibitors which may be used as medicaments.
