83783-53-3 Usage
Description
1-(1-chloro-1-butenyl)-4-fluorobenzene is an organochlorine chemical compound with the molecular formula C10H9ClF. It features a butenyl group attached to a benzene ring, along with a fluorine atom. 1-(1-chloro-1-butenyl)-4-fluorobenzene is known for its role as a reagent or intermediate in the synthesis of various organic compounds and exhibits biological activity, which positions it as a candidate for pharmaceutical or agrochemical development.
Uses
Used in Chemical Synthesis:
1-(1-chloro-1-butenyl)-4-fluorobenzene is utilized as a reagent or intermediate for synthesizing a range of organic compounds. Its unique structure, which includes a chloro-butenyl group and a fluorine atom attached to a benzene ring, makes it a valuable component in creating complex organic molecules for various applications.
Used in Pharmaceutical Development:
Due to its biological activity, 1-(1-chloro-1-butenyl)-4-fluorobenzene is considered for use in the development of pharmaceuticals. Its potential role in medicine could involve the creation of new drugs or the enhancement of existing ones, depending on its specific interactions with biological systems.
Used in Agrochemical Development:
Similarly, the compound's biological activity suggests that it may be employed in the development of agrochemicals. This could include its use in designing new pesticides, herbicides, or other agricultural chemicals that improve crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 83783-53-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,7,8 and 3 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 83783-53:
(7*8)+(6*3)+(5*7)+(4*8)+(3*3)+(2*5)+(1*3)=163
163 % 10 = 3
So 83783-53-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H10ClF/c1-2-3-10(11)8-4-6-9(12)7-5-8/h3-7H,2H2,1H3/b10-3-
