84066-20-6 Usage
General Description
2-[(3-Chloro-2-pyrazinyl)amino]-1-ethanol is a chemical compound that is a derivative of pyrazine. 2-[(3-CHLORO-2-PYRAZINYL)AMINO]-1-ETHANOL is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs and pharmaceuticals. It has been found to have potential anti-tumor and anti-inflammatory properties, making it a valuable compound for drug development. Additionally, it may also be used as an insecticide or pesticide due to its potential toxicological properties. This chemical is important in the field of medicinal chemistry and drug research due to its versatile applications and potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 84066-20-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,0,6 and 6 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 84066-20:
(7*8)+(6*4)+(5*0)+(4*6)+(3*6)+(2*2)+(1*0)=126
126 % 10 = 6
So 84066-20-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H8ClN3O/c7-5-6(10-3-4-11)9-2-1-8-5/h1-2,11H,3-4H2,(H,9,10)
