84387-89-3 Usage
Description
3-Amino-5-nitrobenzisothiazole is an organic compound that forms a 1:1 complex with β-cyclodextrin (β-CDx). It exhibits unique structural and photoprototropic features, making it a versatile molecule for various applications.
Uses
Used in Pharmaceutical Industry:
3-Amino-5-nitrobenzisothiazole is used as a pharmaceutical intermediate for the synthesis of various drugs. Its complexation with β-cyclodextrin enhances the solubility, stability, and bioavailability of the resulting drug molecules, improving their therapeutic efficacy.
Used in Supramolecular Chemistry:
3-Amino-5-nitrobenzisothiazole is used as a building block in supramolecular chemistry due to its ability to form complexes with β-cyclodextrin. This property allows for the development of novel supramolecular systems with potential applications in drug delivery, sensors, and other areas.
Used in Material Science:
The photoprototropic features of the 3-Amino-5-nitrobenzisothiazole-β-cyclodextrin complex make it a promising candidate for the development of smart materials with tunable properties. These materials can be used in various applications, such as responsive drug delivery systems, optical sensors, and molecular switches.
Check Digit Verification of cas no
The CAS Registry Mumber 84387-89-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,3,8 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 84387-89:
(7*8)+(6*4)+(5*3)+(4*8)+(3*7)+(2*8)+(1*9)=173
173 % 10 = 3
So 84387-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O2S/c8-7-5-3-4(10(11)12)1-2-6(5)13-9-7/h1-3H,(H2,8,9)
