849061-98-9 Usage
Description
2-FLUORO-3-FORMYLPHENYLBORONIC ACID is an organic compound that features a boron atom bonded to a phenyl ring with a fluorine atom at the 2-position and a formyl group at the 3-position. This unique structure endows it with specific reactivity and properties that make it a valuable intermediate in organic synthesis.
Uses
Used in Pharmaceutical Industry:
2-FLUORO-3-FORMYLPHENYLBORONIC ACID is used as a key reactant in the synthesis of various pharmaceutical compounds, particularly those containing aryl-substituted oxabenzindoles and methanobenzindoles. Its unique structure allows for the formation of complex molecules with potential therapeutic applications.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-FLUORO-3-FORMYLPHENYLBORONIC ACID is used as a reactant in Suzuki-Miyaura coupling reactions. This versatile cross-coupling reaction enables the formation of carbon-carbon bonds between an organoboron compound and an organohalide, facilitating the synthesis of a wide range of organic molecules, including those with potential applications in materials science, agrochemicals, and pharmaceuticals.
Used in Research and Development:
2-FLUORO-3-FORMYLPHENYLBORONIC ACID is also utilized in research and development settings, where its unique reactivity and properties can be explored for the discovery of new synthetic routes and the development of novel compounds with specific functions or properties. Its use in Suzuki reactions allows researchers to access a variety of aryl-substituted scaffolds, which can be further modified or functionalized to create new molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 849061-98-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,9,0,6 and 1 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 849061-98:
(8*8)+(7*4)+(6*9)+(5*0)+(4*6)+(3*1)+(2*9)+(1*8)=199
199 % 10 = 9
So 849061-98-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BFO3/c9-7-5(4-10)2-1-3-6(7)8(11)12/h1-4,11-12H
