84957-30-2 Usage
Description
1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt is a complex organic compound with a unique chemical structure. It is characterized by its quinolinium inner salt form and the presence of various functional groups, including amino, thiazolyl, and methoxyimino moieties. 1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt has potential applications in various fields due to its unique properties and reactivity.
Uses
Used in Veterinary Medicine:
1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt is used as an antibacterial agent in veterinary medicine. It exhibits broad-spectrum antimicrobial activity against various bacterial pathogens, making it a valuable tool for treating bacterial infections in animals.
Used in Organic Synthesis:
1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt is also used as a compound in organic synthesis. Its unique structure and reactivity make it a valuable building block for the synthesis of various complex organic molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Cefquinome Synthesis:
1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt is used in the synthesis of Cefquinome (CAS# 84957-30-2), a compound with potential applications in various fields. Its unique structure and reactivity contribute to the formation of the desired product, making it an essential component in the synthesis process.
Check Digit Verification of cas no
The CAS Registry Mumber 84957-30-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,9,5 and 7 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 84957-30:
(7*8)+(6*4)+(5*9)+(4*5)+(3*7)+(2*3)+(1*0)=172
172 % 10 = 2
So 84957-30-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H24N6O5S2/c1-34-27-16(14-11-36-23(24)25-14)19(30)26-17-20(31)29-18(22(32)33)13(10-35-21(17)29)9-28-8-4-6-12-5-2-3-7-15(12)28/h4,6,8,11,17,21H,2-3,5,7,9-10H2,1H3,(H3-,24,25,26,30,32,33)/b27-16+/t17-,21-/m1/s1
84957-30-2Relevant articles and documents
Method for producing cephalosporins
-
Page 3, (2010/02/05)
A method for producing cephalosporins 7-substituted with an amino-thiazolylacetic group by reacting 7-ACA or its derivatives having the amino group and the carboxyl protected with reactive derivatives of amino-thiazolylacetic acid.