85-39-2 Usage
General Description
5-NORBORNENE-2,3-DIMETHANOL is a chemical compound with the molecular formula C9H14O2. It is a colorless liquid with a molecular weight of 154.21 g/mol. 5-NORBORNENE-2,3-DIMETHANOL is used as a building block in the synthesis of various organic compounds and materials. It is also known for its potential application in the development of functional polymers and pharmaceuticals. The presence of two hydroxyl groups in its structure makes it a valuable intermediate for the production of esters and ethers. Additionally, it has been studied for its potential use as a reactive diluent in epoxy resins and as a curing agent in polymer formulations. Overall, 5-NORBORNENE-2,3-DIMETHANOL has a wide range of potential industrial and research applications due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 85-39-2 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 85-39:
(4*8)+(3*5)+(2*3)+(1*9)=62
62 % 10 = 2
So 85-39-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2
85-39-2Relevant articles and documents
Process for producing norbornene derivatives
-
Page/Page column 11-12, (2008/06/13)
The invention relates to a process for producing alkyl norbornene derivatives which are useful for radically curable compounds or as precursors of epoxy compounds. The process comprises: reacting an allyl compound (A) having an allyl group represented by the following formula (1), wherein R 1 represents a hydrogen atom, an alkyl group, a hydroxyl alkyl group, or an alkoxy alkyl group, with alkyl-cyclopentadiene dimer (B).