851386-35-1 Usage
General Description
5-Iodo-2,3-difluoropyridine is a chemical compound with the molecular formula C5H2F2IN. It is a halogenated pyridine derivative, which is commonly used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. 5-Iodo-2,3-difluoropyridine is known for its ability to undergo various chemical reactions, making it a versatile intermediate for the production of diverse chemical products. It is important to handle this chemical with caution, as it may present health and safety hazards if not properly managed. Overall, 5-Iodo-2,3-difluoropyridine is a valuable chemical in the field of organic synthesis and plays a crucial role in the development of new chemical compounds for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 851386-35-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,1,3,8 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 851386-35:
(8*8)+(7*5)+(6*1)+(5*3)+(4*8)+(3*6)+(2*3)+(1*5)=181
181 % 10 = 1
So 851386-35-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H2F2IN/c6-4-1-3(8)2-9-5(4)7/h1-2H
