851386-38-4 Usage
General Description
5,6-Difluoropyridine-2-carboxylic acid is a chemical compound that contains a pyridine ring with two fluorine atoms at the 5 and 6 positions, as well as a carboxylic acid group attached at the 2 position. It is commonly used as a building block in organic synthesis, particularly in the pharmaceutical industry, where it can be used to create various biologically active compounds. 5,6-Difluoropyridine-2-carboxylic acid has potential applications in the development of new drugs and agrochemicals due to its ability to modify the properties of organic molecules. Additionally, its fluorine atoms give it unique chemical and biological properties that make it valuable in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 851386-38-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,1,3,8 and 6 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 851386-38:
(8*8)+(7*5)+(6*1)+(5*3)+(4*8)+(3*6)+(2*3)+(1*8)=184
184 % 10 = 4
So 851386-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H3F2NO2/c7-3-1-2-4(6(10)11)9-5(3)8/h1-2H,(H,10,11)