85168-85-0 Usage
Description
Bromochloroanthra[2,1,9-mna]benz[6,7]indazolo[2,3,4-fgh]acridine-5,10-dione is a complex anthraquinone compound characterized by the presence of both bromine and chlorine atoms, as well as an acridine-5,10-dione core structure. This intricate molecular structure endows it with potentially unique properties, making it a candidate for various applications in fields such as materials science, pharmaceuticals, or dye synthesis.
Uses
Used in Materials Science:
Bromochloroanthra[2,1,9-mna]benz[6,7]indazolo[2,3,4-fgh]acridine-5,10-dione is used as a component in the development of advanced materials due to its unique molecular structure and potential for creating novel material properties.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, bromochloroanthra[2,1,9-mna]benz[6,7]indazolo[2,3,4-fgh]acridine-5,10-dione is utilized as a starting material or intermediate in the synthesis of new drugs, potentially targeting various therapeutic areas based on its chemical properties.
Used in Dye Synthesis:
Bromochloroanthra[2,1,9-mna]benz[6,7]indazolo[2,3,4-fgh]acridine-5,10-dione is employed as a dye precursor in the synthesis of new dyes, taking advantage of its vivid color characteristics and the possibility of creating dyes with specific properties for various applications.
Further research and analysis are required to fully understand the characteristics and potential applications of bromochloroanthra[2,1,9-mna]benz[6,7]indazolo[2,3,4-fgh]acridine-5,10-dione, as its complex nature may offer a wide range of possibilities across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 85168-85-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,1,6 and 8 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 85168-85:
(7*8)+(6*5)+(5*1)+(4*6)+(3*8)+(2*8)+(1*5)=160
160 % 10 = 0
So 85168-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C31H12BrClN2O2/c32-27-21(33)11-9-19-24(27)17-10-12-22-25-13(5-7-18(23(17)25)31(19)37)15-6-8-20-26-28(34-35(22)29(15)26)14-3-1-2-4-16(14)30(20)36/h1-12H