852180-45-1 Usage
Description
(5-THIEN-2-YLISOXAZOL-3-YL)METHYLAMINE, with the molecular formula C8H9N3OS, is a chemical compound belonging to the isoxazol derivatives. It is known for its diverse pharmacological activities and unique properties due to the presence of thienyl and isoxazolyl groups in its structure. (5-THIEN-2-YLISOXAZOL-3-YL)METHYLAMINE is significant in the field of medicinal chemistry for its potential applications in developing drugs that target various biological processes.
Uses
Used in Medicinal Chemistry:
(5-THIEN-2-YLISOXAZOL-3-YL)METHYLAMINE is used as a building block for the development of drugs targeting various biological processes. Its unique structure and properties make it a promising candidate for creating novel pharmaceuticals with potential therapeutic applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (5-THIEN-2-YLISOXAZOL-3-YL)METHYLAMINE is used as a key intermediate in the synthesis of various drugs. Its diverse pharmacological activities and potential biological activities contribute to the development of innovative medications for treating different health conditions.
Used in Drug Synthesis and Characterization:
(5-THIEN-2-YLISOXAZOL-3-YL)METHYLAMINE is utilized in the synthesis and characterization of new drugs, allowing researchers to understand its potential applications and optimize its use in the pharmaceutical sector. This process is crucial for advancing the development of effective and safe medications.
Check Digit Verification of cas no
The CAS Registry Mumber 852180-45-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,1,8 and 0 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 852180-45:
(8*8)+(7*5)+(6*2)+(5*1)+(4*8)+(3*0)+(2*4)+(1*5)=161
161 % 10 = 1
So 852180-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2OS/c9-5-6-4-7(11-10-6)8-2-1-3-12-8/h1-4H,5,9H2
