852228-14-9 Usage
General Description
2,5-DIBROMOPYRIDINE-3-BORONIC ACID is a chemical compound with the molecular formula C5H4BBr2N2O2. It is a boronic acid derivative containing both bromine and boron atoms. 2,5-DIBROMOPYRIDINE-3-BORONIC ACID is commonly used in organic synthesis and chemical research, particularly in the development of pharmaceuticals and agrochemicals. It is known for its ability to undergo various chemical reactions, including Suzuki-Miyaura coupling, which makes it a valuable building block in the production of complex organic molecules. 2,5-DIBROMOPYRIDINE-3-BORONIC ACID is also used as a reagent in the preparation of heterocyclic compounds and coordination complexes.
Check Digit Verification of cas no
The CAS Registry Mumber 852228-14-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,2,2 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 852228-14:
(8*8)+(7*5)+(6*2)+(5*2)+(4*2)+(3*8)+(2*1)+(1*4)=159
159 % 10 = 9
So 852228-14-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BBr2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
