857283-59-1 Usage
General Description
1-(3-Isocyanatophenyl)-1H-pyrrole is a chemical compound with the molecular formula C11H8N2O. It is a pyrrole derivative with an isocyanate group attached to the phenyl ring. 1-(3-ISOCYANATOPHENYL)-1H-PYRROLE is used in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and materials. It is also a versatile building block in organic chemistry, and its unique structure and reactivity make it valuable in the development of new molecules and materials. Additionally, 1-(3-Isocyanatophenyl)-1H-pyrrole has been studied for its potential biological activities, including its cytotoxic and antiproliferative effects on cancer cells, making it a potential candidate for drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 857283-59-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,2,8 and 3 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 857283-59:
(8*8)+(7*5)+(6*7)+(5*2)+(4*8)+(3*3)+(2*5)+(1*9)=211
211 % 10 = 1
So 857283-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O/c14-9-12-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H
