86060-99-3 Usage
Description
FMOC-ASN-OPFP, also known as 9-fluorenylmethoxycarbonyl-L-asparagine pentafluorophenyl ester, is an L-asparagine derivative that is commonly used in peptide synthesis and as a reagent in various biochemical applications. It is characterized by its ability to protect the amino group of asparagine during peptide synthesis, allowing for the controlled formation of peptide bonds.
Uses
Used in Peptide Synthesis:
FMOC-ASN-OPFP is used as a protecting group for the amino group of asparagine during peptide synthesis. This protection allows for the controlled formation of peptide bonds and prevents unwanted side reactions, leading to the efficient synthesis of desired peptides.
Used in Biochemical Research:
FMOC-ASN-OPFP is used as a reagent in various biochemical applications, including the assessment of cross-reactivity of cellulose membrane-bound peptides. Its use in this context helps researchers to better understand the interactions between peptides and other biomolecules, as well as to develop new methods for peptide immobilization and analysis.
Used in Pharmaceutical Development:
FMOC-ASN-OPFP is also used in the development of new pharmaceuticals, particularly in the synthesis of peptide-based drugs. Its ability to protect the amino group of asparagine allows for the efficient synthesis of complex peptide structures, which can be further modified and optimized for therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 86060-99-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,0,6 and 0 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 86060-99:
(7*8)+(6*6)+(5*0)+(4*6)+(3*0)+(2*9)+(1*9)=143
143 % 10 = 3
So 86060-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C25H17F5N2O5/c26-18-19(27)21(29)23(22(30)20(18)28)37-24(34)16(9-17(31)33)32-25(35)36-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H2,31,33)(H,32,35)/t16-/m0/s1