86641-76-1 Usage
Description
Spirobromin is a synthetic chemical compound that serves as an intermediate in the production of pharmaceuticals. It belongs to the spiropyrrolidine derivative class, characterized by a unique chemical structure featuring a three-membered ring and a nitrogen atom. Known for its reactivity and capacity to form complex structures, spirobromin has been studied for its potential applications in the synthesis of various drug molecules. Additionally, it has been considered for use in organic synthesis and as a building block in developing new chemical processes. Further research is necessary to fully explore its potential uses and properties.
Uses
Used in Pharmaceutical Industry:
Spirobromin is utilized as a key intermediate in the synthesis of various drug molecules, leveraging its reactivity and ability to form complex structures for creating novel pharmaceutical compounds.
Used in Organic Synthesis:
In the field of organic synthesis, spirobromin is employed as a building block, contributing to the development of new chemical processes and the creation of innovative organic compounds.
Used in Chemical Research:
Spirobromin is also used in chemical research to explore its potential applications and properties further, with the aim of expanding its use in various industries and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 86641-76-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,6,4 and 1 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 86641-76:
(7*8)+(6*6)+(5*6)+(4*4)+(3*1)+(2*7)+(1*6)=161
161 % 10 = 1
So 86641-76-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H32Br2N4O2.2ClH/c19-3-1-17(25)21-5-9-23(10-6-21)13-15-24(16-14-23)11-7-22(8-12-24)18(26)2-4-20;;/h1-16H2;2*1H/q+2;;/p-2