872041-95-7 Usage
Description
(2,5-DIFLUOROPYRIDIN-3-YL)BORONIC ACID is an organic boron compound characterized by the presence of a boron atom bonded to a 2,5-difluoropyridin-3-yl group. (2,5-DIFLUOROPYRIDIN-3-YL)BORONIC ACID exhibits unique chemical properties due to the presence of fluorine atoms and the boron atom, making it a versatile building block in organic synthesis and a potential candidate for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
(2,5-DIFLUOROPYRIDIN-3-YL)BORONIC ACID is used as a key intermediate in the synthesis of Azacarboline compounds for the detection of Tau aggregates. These Azacarboline compounds are valuable in the development of diagnostic tools and therapeutic agents targeting neurodegenerative diseases, such as Alzheimer's disease, where the presence of Tau aggregates is a significant pathological feature.
Check Digit Verification of cas no
The CAS Registry Mumber 872041-95-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,2,0,4 and 1 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 872041-95:
(8*8)+(7*7)+(6*2)+(5*0)+(4*4)+(3*1)+(2*9)+(1*5)=167
167 % 10 = 7
So 872041-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H4BF2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
