87388-06-5 Usage
General Description
4-(2,4-Dichlorophenyl)-1H-pyrrole-3-carbonitrile is a chemical compound with the molecular formula C11H6Cl2N2. It is a pyrrole derivative, which is a heterocyclic aromatic organic compound. This chemical is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its diverse biological activities, such as antimicrobial, antifungal, and antitumor properties. The compound has potential applications in the development of new drugs and agricultural products. Additionally, it may also be used in research and development in the fields of medicine and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 87388-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,3,8 and 8 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 87388-06:
(7*8)+(6*7)+(5*3)+(4*8)+(3*8)+(2*0)+(1*6)=175
175 % 10 = 5
So 87388-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H6Cl2N2/c12-8-1-2-9(11(13)3-8)10-6-15-5-7(10)4-14/h1-3,5-6,15H
