874219-22-4 Usage
General Description
3-(Benzylcarbamoyl)-4-fluorobenzenboronic acid is a boronic acid derivative with the chemical formula C14H13BFNO3. It is primarily used in the field of organic chemistry as a reactant in the synthesis of various pharmaceuticals and biologically active compounds. This chemical is known for its ability to form stable complexes with diols and has been studied for its potential in medicinal chemistry. Additionally, it has been investigated for its anti-tumor and anti-inflammatory properties. Its boronic acid functionality allows it to participate in Suzuki-Miyaura cross-coupling reactions, making it a valuable tool for the construction of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 874219-22-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,1 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 874219-22:
(8*8)+(7*7)+(6*4)+(5*2)+(4*1)+(3*9)+(2*2)+(1*2)=184
184 % 10 = 4
So 874219-22-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BFNO3/c16-13-7-6-11(15(19)20)8-12(13)14(18)17-9-10-4-2-1-3-5-10/h1-8,19-20H,9H2,(H,17,18)
