874459-76-4 Usage
General Description
(3-Isobutyramido)benzeneboronic acid is a boronic acid derivative with the chemical formula C10H15BNO3. It is a white solid compound that is commonly used in chemical research and synthesis. It is a key reagent in the Suzuki reaction, a widely used organic coupling reaction to form carbon-carbon bonds. (3-ISOBUTYRAMIDO)BENZENEBORONIC ACID possesses unique properties that make it a valuable tool in the field of organic chemistry, allowing for the efficient and selective formation of complex molecules. Its ability to form stable and reversible complexes with diols, amines, and other organic molecules also makes it useful for a variety of applications in drug discovery and material science. Overall, (3-Isobutyramido)benzeneboronic acid plays a crucial role in the development of new chemical entities and synthetic methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 874459-76-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,4,5 and 9 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 874459-76:
(8*8)+(7*7)+(6*4)+(5*4)+(4*5)+(3*9)+(2*7)+(1*6)=224
224 % 10 = 4
So 874459-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO3/c1-7(2)10(13)12-9-5-3-4-8(6-9)11(14)15/h3-7,14-15H,1-2H3,(H,12,13)