875576-30-0 Usage
General Description
2-(4-Acetyl-piperazin-1-yl)-6-chloroaniline is a chemical compound that is characterized by a piperazine ring with an acetyl group attached at the 4-position and a chlorine atom on the 6-position of an aniline ring. 2-(4-Acetyl-piperazin-1-yl)-6-chloroaniline can be used in various chemical and pharmaceutical applications due to its unique structure and properties. It may act as a building block for the synthesis of other compounds or as a potential pharmacophore for drug development. Additionally, it may have biological activities or interactions with specific targets, making it a valuable tool in medicinal chemistry research. Overall, 2-(4-Acetyl-piperazin-1-yl)-6-chloroaniline has potential uses in the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 875576-30-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,5,5,7 and 6 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 875576-30:
(8*8)+(7*7)+(6*5)+(5*5)+(4*7)+(3*6)+(2*3)+(1*0)=220
220 % 10 = 0
So 875576-30-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H16ClN3O/c1-9(17)15-5-7-16(8-6-15)11-4-2-3-10(13)12(11)14/h2-4H,5-8,14H2,1H3
