88611-91-0 Usage
Description
2-(4,6-dimethyl-1H-indol-3-yl)acetic acid is a chemical compound with the molecular formula C13H13NO2. It is an indole derivative featuring a carboxylic acid functional group, making it a carboxylic acid derivative. Derived from indole, a heterocyclic aromatic organic compound, this versatile and valuable chemical is commonly used as a building block in the synthesis of pharmaceuticals and other organic compounds.
Uses
Used in Pharmaceutical Industry:
2-(4,6-dimethyl-1H-indol-3-yl)acetic acid is used as a building block for the synthesis of pharmaceuticals due to its versatile chemical structure and properties. It plays a crucial role in the development of new drugs and medicinal compounds, contributing to advancements in healthcare and medicine.
Used in Organic Synthesis:
In the field of organic chemistry, 2-(4,6-dimethyl-1H-indol-3-yl)acetic acid is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for a wide range of reactions and transformations, making it a valuable component in the creation of specialty chemicals and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 88611-91-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,6,1 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 88611-91:
(7*8)+(6*8)+(5*6)+(4*1)+(3*1)+(2*9)+(1*1)=160
160 % 10 = 0
So 88611-91-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO2/c1-7-3-8(2)12-9(5-11(14)15)6-13-10(12)4-7/h3-4,6,13H,5H2,1-2H3,(H,14,15)
