89-27-0 Usage
Description
4,5-dihydro-1-(3-nitrophenyl)-5-oxo-1H-pyrazole-3-carboxylic acid is a pyrazole derivative with a molecular formula C11H8N4O5, featuring a carboxylic acid functional group and a nitrophenyl substituent. This yellow crystalline solid is insoluble in water and is considered a potentially bioactive molecule. Its chemical structure indicates that it may possess inhibitory or bactericidal properties, making it a promising candidate for pharmaceutical research and the development of new drugs.
Uses
Used in Pharmaceutical Research:
4,5-dihydro-1-(3-nitrophenyl)-5-oxo-1H-pyrazole-3-carboxylic acid is used as a potentially bioactive molecule for the development of new drugs in the pharmaceutical industry. Its unique chemical structure suggests that it may have inhibitory or bactericidal activity, which can be further explored for the creation of novel therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4,5-dihydro-1-(3-nitrophenyl)-5-oxo-1H-pyrazole-3-carboxylic acid is used as a candidate for further study. Its potential inhibitory or bactericidal properties make it an interesting compound to investigate for possible applications in the treatment or prevention of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 89-27-0 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 9 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 89-27:
(4*8)+(3*9)+(2*2)+(1*7)=70
70 % 10 = 0
So 89-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3O5/c14-9-5-8(10(15)16)11-12(9)6-2-1-3-7(4-6)13(17)18/h1-4H,5H2,(H,15,16)
