893620-30-9 Usage
General Description
2-Chloro-4-fluoroquinoline is a chemical compound with the molecular formula C9H5ClFNO. It is a quinoline derivative, which is a class of aromatic compounds commonly found in various pharmaceuticals and agrochemicals. This particular compound is notable for its chlorine and fluorine substituents, which can impart specific chemical and biological properties. 2-Chloro-4-fluoroquinoline may be used as an intermediate in the synthesis of other compounds, such as pharmaceutical ingredients or agrochemicals, and it may also have potential applications in medicinal chemistry and drug discovery research. However, it should be handled and used with care, as it may have hazardous properties and require proper safety precautions and handling procedures.
Check Digit Verification of cas no
The CAS Registry Mumber 893620-30-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,3,6,2 and 0 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 893620-30:
(8*8)+(7*9)+(6*3)+(5*6)+(4*2)+(3*0)+(2*3)+(1*0)=189
189 % 10 = 9
So 893620-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H5ClFN/c10-9-5-7(11)6-3-1-2-4-8(6)12-9/h1-5H
