89374-60-7 Usage
Description
1-(4-BROMOPHENYL)-2-THIOXO-1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIMIDIN-4-ONE is a pyrimidine derivative characterized by the presence of a thioxo group and a bromophenyl moiety. This chemical compound holds potential biological activities and is considered a promising candidate for medicinal chemistry research, particularly in the development of new drugs targeting specific biological pathways. Its structural features contribute to its potential as a therapeutic agent, although further research is necessary to fully comprehend its applications and properties.
Uses
Used in Pharmaceutical Industry:
1-(4-BROMOPHENYL)-2-THIOXO-1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIMIDIN-4-ONE is used as a chemical compound for the development of new drugs due to its potential biological activities and structural features that make it a promising candidate for targeting specific biological pathways.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1-(4-BROMOPHENYL)-2-THIOXO-1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIMIDIN-4-ONE serves as a valuable compound for research purposes. Its unique structure and potential biological activities allow scientists to explore its capabilities in creating therapeutic agents that can address various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 89374-60-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,3,7 and 4 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89374-60:
(7*8)+(6*9)+(5*3)+(4*7)+(3*4)+(2*6)+(1*0)=177
177 % 10 = 7
So 89374-60-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H8BrN3OS/c14-8-3-5-9(6-4-8)17-11-10(2-1-7-15-11)12(18)16-13(17)19/h1-7H,(H,16,18,19)
