89498-91-9 Usage
General Description
Picrasil B is a chemical compound primarily used as a non-ionic surfactant in the production of emulsions and dispersion formulations. It is classified as a polyoxyethylated castor oil that can be used in a wide range of industries, including agriculture, pharmaceuticals, and cosmetics. It is known for its ability to reduce the surface tension of liquids, improve emulsification, and enhance the stability of formulations. Picrasil B is also used as a dispersing agent for pigments and dyes, as well as a solubilizer for essential oils and other hydrophobic compounds. Additionally, it has been found to have antimicrobial properties, making it a versatile and valuable chemical in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 89498-91-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,4,9 and 8 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 89498-91:
(7*8)+(6*9)+(5*4)+(4*9)+(3*8)+(2*9)+(1*1)=209
209 % 10 = 9
So 89498-91-9 is a valid CAS Registry Number.
InChI:InChI=1/C22H32O6/c1-10-6-14(25-5)20(24)22(4)12(10)7-15-21(3)13(8-16(23)28-15)11(2)17-18(19(21)22)27-9-26-17/h6,10-13,15-19,23H,7-9H2,1-5H3