89799-07-5 Usage
Description
Isoxazolo[5,4-d]pyrimidin-4-amine, 3-methyl(9CI) is a chemical compound characterized by the molecular formula C6H7N3O. It is a derivative of isoxazolo[5,4-d]pyrimidin-4-amine, featuring a methyl group attached to the third carbon atom. Isoxazolo[5,4-d]pyrimidin-4-amine, 3-methyl(9CI) holds promise in medicinal chemistry, particularly for the development of pharmaceutical drugs, due to its unique structure and properties. It is a subject of interest for further research and development in drug discovery, and may also find applications in other scientific and industrial fields.
Uses
Used in Pharmaceutical Drug Development:
Isoxazolo[5,4-d]pyrimidin-4-amine, 3-methyl(9CI) is utilized as a key intermediate in the synthesis of various pharmaceutical drugs. Its unique chemical structure allows it to be a versatile building block for the creation of novel therapeutic agents, potentially leading to the development of new medications with improved efficacy and safety profiles.
Used in Medicinal Chemistry Research:
Isoxazolo[5,4-d]pyrimidin-4-amine, 3-methyl(9CI) serves as a valuable research tool in medicinal chemistry, where it can be used to study the structure-activity relationships of various drug candidates. By examining the interactions of Isoxazolo[5,4-d]pyrimidin-4-amine, 3-methyl(9CI) with different biological targets, researchers can gain insights into the design of more effective and selective drugs.
Used in Chemical Synthesis:
Isoxazolo[5,4-d]pyrimidin-4-amine, 3-methyl(9CI) may also be employed in the synthesis of other organic compounds and materials, given its reactive functional groups and potential for further chemical modification. This can lead to the development of new chemical entities with applications in various industries, such as materials science, agrochemicals, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 89799-07-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,7,9 and 9 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 89799-07:
(7*8)+(6*9)+(5*7)+(4*9)+(3*9)+(2*0)+(1*7)=215
215 % 10 = 5
So 89799-07-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4O/c1-3-4-5(7)8-2-9-6(4)11-10-3/h2H,1H3,(H2,7,8,9)
89799-07-5Relevant articles and documents
N-ARYL-ISOXAZOLOPYRIMIDIN-4-AMINES AND RELATED COMPOUNDS AS ACTIVATORS OF CASPASES AND INDUCERS OF APOPTOSIS AND THE USE THEREOF
-
Page/Page column 50, (2008/12/05)
Disclosed are N-aryl-isoxazolopyrimidin-4-amines and related compounds thereof, represented by the Formula (I): wherein Ar, R1-R5, A, B, D, E, F and H are defined herein. The present invention relates to the discovery that compounds having Formula I are activators of caspases and inducers of apoptosis. Therefore, the activators of caspases and inducers of apoptosis of this invention may be used to induce cell death in a variety of clinical conditions in which uncontrolled growth and spread of abnormal cells occurs.