89894-30-4 Usage
General Description
1,2,4-Thiadiazol-3-amine, 5-(4-chlorophenyl)- is a chemical compound with the molecular formula C7H6ClN3S. It is a member of the thiadiazole family of compounds, which are known for their diverse range of biological activities. This specific compound is of interest due to its potential use as a pharmaceutical intermediate or in the synthesis of agrochemicals. Additionally, it has been studied for its potential as an anti-cancer agent and as a pesticide. The presence of the chlorophenyl group in this compound may contribute to its specific biological activity and potential applications, making it a valuable target for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 89894-30-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,8,9 and 4 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89894-30:
(7*8)+(6*9)+(5*8)+(4*9)+(3*4)+(2*3)+(1*0)=204
204 % 10 = 4
So 89894-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClN3S/c9-6-3-1-5(2-4-6)7-11-8(10)12-13-7/h1-4H,(H2,10,12)