90012-40-1 Usage
Description
2-PHENYL-5-P-TOLYL-2H-PYRAZOL-3-YLAMINE is an organic compound with the chemical formula C16H14N2. It is a derivative of pyrazole, a heterocyclic compound with a five-membered ring containing two nitrogen atoms. The presence of phenyl and p-tolyl groups in its structure endows it with unique chemical and physical properties.
Uses
Used in Pharmaceutical Industry:
2-PHENYL-5-P-TOLYL-2H-PYRAZOL-3-YLAMINE is used as an intermediate in the synthesis of various pharmaceutical compounds. It plays a crucial role in the preparation of N′-[4-formyl-3-(4-methylphenyl)-1-phenyl-1H-pyrazol-5-yl]-N,N-dimethylimidoformamide, which is an essential precursor for the synthesis of 5-amino-3-(4-methylphenyl)-1-phenyl-1H-pyrazole-4-carbaldehyde. This aldehyde can be further utilized in the development of drugs with potential therapeutic applications.
Used in Chemical Research:
2-PHENYL-5-P-TOLYL-2H-PYRAZOL-3-YLAMINE is also used as a research compound in various chemical studies. Its unique structure and properties make it a valuable tool for understanding the reactivity and behavior of pyrazole derivatives. Researchers can use this compound to explore new synthetic routes, develop novel catalysts, and investigate the potential applications of pyrazole-based materials in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 90012-40-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,0,1 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 90012-40:
(7*9)+(6*0)+(5*0)+(4*1)+(3*2)+(2*4)+(1*0)=81
81 % 10 = 1
So 90012-40-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H15N3/c1-12-7-9-13(10-8-12)15-11-16(17)19(18-15)14-5-3-2-4-6-14/h2-11H,17H2,1H3
