902836-26-4 Usage
General Description
"[3-(3-Fluoro-benzyloxy)-phenyl]-acetic acid" is a chemical compound with a specific molecular structure, represented by the presence of Fluoro-benzyloxy phenyl group attached to an acetic acid. The presence of the fluorine atom indicates that it's a type of fluorinated compound, which suggests that the compound could have specific desirable properties, such as increased stability, bioavailability and selective binding capabilities in pharmaceutical contexts. The benzyloxy group facilitates the transformation of some reactive groups into more stable and non-reactive forms. Acetic acid is a simple carboxylic acid that often plays a crucial role in biochemical processes. The detailed properties or uses of this specific compound might vary significantly and would need to be determined through laboratory synthesis and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 902836-26-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 902836-26:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*6)+(2*2)+(1*6)=164
164 % 10 = 4
So 902836-26-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H13FO3/c16-13-5-1-4-12(7-13)10-19-14-6-2-3-11(8-14)9-15(17)18/h1-8H,9-10H2,(H,17,18)
902836-26-4Relevant articles and documents
Synthesis and aldose reductase inhibitory activities of novel O-substituted hydroxyphenylacetic acid derivatives
Rakowitz, Dietmar,Angerer, Helga,Matuszczak, Barbara
, p. 547 - 558 (2007/10/03)
In continuation of our work aimed towards the preparation of novel aldose reductase inhibitors, several O-substituted hydroxyphenylacetic acid derivatives were investigated. The highest inhibitory activity was found for compounds 7b and 7c bearing a cyclo
