904816-43-9 Usage
Description
1-(2-Benzo[1,3]dioxol-5-yl-imidazo[1,2-a]pyridin-3-ylmethyl)-piperidine-3-carboxylic acid is a complex organic compound characterized by its unique molecular structure. It features a piperidine ring, a carboxylic acid group, an imidazo[1,2-a]pyridin-3-ylmethyl side chain, and a benzo[1,3]dioxol-5-yl group. 1-(2-BENZO[1,3]DIOXOL-5-YL-IMIDAZO[1,2-A]PYRIDIN-3-YLMETHYL)-PIPERIDINE-3-CARBOXYLIC ACID may hold potential pharmaceutical or biochemical applications due to its diverse chemical and pharmacological properties. Further research is necessary to explore its full potential and effects.
Uses
Used in Pharmaceutical Industry:
1-(2-Benzo[1,3]dioxol-5-yl-imidazo[1,2-a]pyridin-3-ylmethyl)-piperidine-3-carboxylic acid is used as a potential pharmaceutical compound for its diverse chemical and pharmacological properties. 1-(2-BENZO[1,3]DIOXOL-5-YL-IMIDAZO[1,2-A]PYRIDIN-3-YLMETHYL)-PIPERIDINE-3-CARBOXYLIC ACID's unique molecular structure may allow it to interact with various biological targets, making it a candidate for the development of new drugs.
Used in Biochemical Research:
In the field of biochemical research, 1-(2-Benzo[1,3]dioxol-5-yl-imidazo[1,2-a]pyridin-3-ylmethyl)-piperidine-3-carboxylic acid can be utilized as a research tool to study the interactions between different biomolecules. Its unique structure may provide insights into the mechanisms of various biological processes and contribute to the understanding of complex biochemical pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 904816-43-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,4,8,1 and 6 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 904816-43:
(8*9)+(7*0)+(6*4)+(5*8)+(4*1)+(3*6)+(2*4)+(1*3)=169
169 % 10 = 9
So 904816-43-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H21N3O4/c25-21(26)15-4-3-8-23(11-15)12-16-20(22-19-5-1-2-9-24(16)19)14-6-7-17-18(10-14)28-13-27-17/h1-2,5-7,9-10,15H,3-4,8,11-13H2,(H,25,26)