912569-64-3 Usage
General Description
3-[(6-Methylpyrazin-2-yl)oxy]benzyl chloride is a chemical compound with the formula C12H11ClN2O. It is an organochlorine compound that contains a benzyl chloride group and a methylpyrazinyl group. The compound is commonly used in organic synthesis and pharmaceutical research, particularly in the production of various drugs and active pharmaceutical ingredients. It is also utilized as a reagent in chemical reactions, such as nucleophilic substitution and other organic transformations. Additionally, 3-[(6-Methylpyrazin-2-yl)oxy]benzyl chloride may have potential applications as an intermediate in the synthesis of various biologically active compounds and as a building block in the development of new chemical entities. Overall, this compound has diverse uses in the field of chemistry and pharmaceutical sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 912569-64-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,2,5,6 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 912569-64:
(8*9)+(7*1)+(6*2)+(5*5)+(4*6)+(3*9)+(2*6)+(1*4)=183
183 % 10 = 3
So 912569-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H11ClN2O/c1-9-7-14-8-12(15-9)16-11-4-2-3-10(5-11)6-13/h2-5,7-8H,6H2,1H3
