913835-37-7 Usage
General Description
4-(3-Chloro-4-methylphenylcarbamoyl)phenylboronic acid is a chemical compound that belongs to the class of boronic acids. It contains a boronic acid group and a phenylcarbamoyl group, which makes it useful for various synthetic applications, especially in organic chemistry and medicinal chemistry. 4-(3-CHLORO-4-METHYLPHENYLCARBAMOYL)PHENYLBORONIC ACID is often used as a reagent in Suzuki-Miyaura cross-coupling reactions to form carbon-carbon bonds. It has also been studied for its potential therapeutic applications, including as an anti-cancer agent, due to its ability to inhibit specific enzymes and proteins involved in cancer cell growth and migration. Overall, 4-(3-Chloro-4-methylphenylcarbamoyl)phenylboronic acid is a versatile compound with important synthetic and medicinal properties.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-37-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 913835-37:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*3)+(1*7)=177
177 % 10 = 7
So 913835-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BClNO3/c1-9-2-7-12(8-13(9)16)17-14(18)10-3-5-11(6-4-10)15(19)20/h2-8,19-20H,1H3,(H,17,18)
