91616-36-3 Usage
Description
(2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL, also known as 3-Hydroxymethyl-2-methyl-1,2,4-triazole, is a white solid compound with the chemical formula C5H9N3O. It is a heterocyclic organic compound that belongs to the triazole family and is characterized by the presence of a hydroxymethyl group attached to a methyl-substituted triazole ring. (2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL is known for its unique chemical properties and is widely used in various applications across different industries.
Uses
Used in Organic Synthesis:
(2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL is used as a synthetic intermediate for the production of various organic compounds. Its unique structure and reactivity make it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals. (2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL's versatility allows for the formation of a wide range of products through various chemical reactions, such as condensation, substitution, and cyclization.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL is used as a key intermediate in the synthesis of triazole-based drugs. These drugs possess a broad range of therapeutic applications, including antifungal, antibacterial, and antiviral properties. (2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL's ability to form stable and bioactive molecules makes it an essential component in the development of new and effective medications.
Used in Agrochemical Industry:
(2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL is also utilized in the agrochemical industry as a precursor for the synthesis of triazole-based fungicides. These fungicides are widely used to protect crops from various fungal infections, ensuring high yields and crop quality. (2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL's ability to form effective and long-lasting protective agents makes it a valuable asset in the development of modern agrochemicals.
Used in Research and Development:
In the field of research and development, (2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL serves as a valuable compound for studying the properties and reactivity of triazole-based compounds. Its unique structure allows researchers to explore new synthetic routes, reaction mechanisms, and potential applications in various fields. (2-METHYL-2H-[1,2,4]TRIAZOL-3-YL)-METHANOL's versatility and stability make it an ideal candidate for investigating new chemical transformations and developing innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 91616-36-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,6,1 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 91616-36:
(7*9)+(6*1)+(5*6)+(4*1)+(3*6)+(2*3)+(1*6)=133
133 % 10 = 3
So 91616-36-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H7N3O/c1-7-4(2-8)5-3-6-7/h3,8H,2H2,1H3
91616-36-3Relevant articles and documents
Substances for treatment or relief of pain
-
Paragraph 0263; 0264, (2016/01/25)
Disclosed is the use of an inverse agonist for alpha-subunit-containing gamma-aminobutyric acid A receptor in the preparation of a medicine for the prevention, alleviation, or treatment of pain.
