91668-84-7 Usage
Description
2-bromo-6-methylpyridine 1-oxide is a chemical compound that features a pyridine ring with a bromine atom at the 2-position, a methyl group at the 6-position, and an oxygen atom bound to the 1-position of the pyridine ring. 2-bromo-6-methylpyridine 1-oxide is known for its potential applications in various fields due to its unique structure and properties.
Uses
Used in Pharmaceutical Industry:
2-bromo-6-methylpyridine 1-oxide is used as a reactant in organic synthesis for the production of pharmaceuticals. Its unique structure allows it to be a key component in the creation of new drugs, contributing to the development of novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical industry, 2-bromo-6-methylpyridine 1-oxide is utilized as a reactant in the synthesis of agrochemicals. Its antimicrobial and antifungal properties make it a valuable compound in the development of new agricultural products aimed at controlling pests and diseases.
Used as an Antimicrobial Agent:
2-bromo-6-methylpyridine 1-oxide is used as an antimicrobial agent due to its ability to inhibit the growth of certain microorganisms. This property can be harnessed in the development of new drugs or products to combat microbial infections.
Used as an Antifungal Agent:
2-bromo-6-methylpyridine 1-oxide is also used as an antifungal agent, leveraging its capacity to prevent the growth of fungi. This can be particularly useful in both medical and agricultural settings to address fungal infections and protect crops.
Used in Chemical Research:
2-bromo-6-methylpyridine 1-oxide serves as a reagent in various chemical reactions, showcasing its versatility in synthetic applications. Researchers use this compound to explore new reaction pathways and develop innovative chemical processes.
Safety:
It is important to exercise safety precautions when handling 2-bromo-6-methylpyridine 1-oxide, as it is classified as a hazardous material. Proper protective measures should be taken to minimize any risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 91668-84-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,6,6 and 8 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 91668-84:
(7*9)+(6*1)+(5*6)+(4*6)+(3*8)+(2*8)+(1*4)=167
167 % 10 = 7
So 91668-84-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BrNO/c1-5-3-2-4-6(7)8(5)9/h2-5H,1H3/q+1
