91712-41-3 Usage
Description
(5Z,8R,9R,10E,12S)-8-acetyl-9-formyl-12-hydroxyheptadeca-5,10-dienoic acid is a complex organic compound characterized by a long hydrocarbon chain and the presence of several functional groups, including a carboxylic acid, an acetyl group, a formyl group, and a hydroxyl group. The molecule also features a series of double bonds, with one in a trans configuration at the 5th and 10th positions. Its unique structure and functional groups endow it with potential biological and pharmaceutical significance, although further research is necessary to fully comprehend its properties and possible applications.
Uses
Used in Pharmaceutical Industry:
(5Z,8R,9R,10E,12S)-8-acetyl-9-formyl-12-hydroxyheptadeca-5,10-dienoic acid is used as a potential pharmaceutical agent for its unique structure and functional groups, which may allow for specific reactivity and interaction with biological molecules. (5Z,8R,9R,10E,12S)-8-acetyl-9-formyl-12-hydroxyheptadeca-5,10-dienoic acid's potential applications in this industry could include the development of new drugs or therapies, targeting various diseases and conditions.
Used in Chemical Research:
In the field of chemical research, (5Z,8R,9R,10E,12S)-8-acetyl-9-formyl-12-hydroxyheptadeca-5,10-dienoic acid can serve as a subject for studying the effects of its structural features on reactivity, stability, and interaction with other molecules. This research could lead to a better understanding of similar compounds and their potential applications in various industries.
Used in Material Science:
(5Z,8R,9R,10E,12S)-8-acetyl-9-formyl-12-hydroxyheptadeca-5,10-dienoic acid's unique structure and functional groups may also make it a candidate for use in material science, where it could be explored for its potential to contribute to the development of new materials with specific properties, such as improved strength, flexibility, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 91712-41-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,7,1 and 2 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 91712-41:
(7*9)+(6*1)+(5*7)+(4*1)+(3*2)+(2*4)+(1*1)=123
123 % 10 = 3
So 91712-41-3 is a valid CAS Registry Number.
InChI:InChI=1/C20H32O5/c1-3-4-7-10-18(23)14-13-17(15-21)19(16(2)22)11-8-5-6-9-12-20(24)25/h5,8,13-15,17-19,23H,3-4,6-7,9-12H2,1-2H3,(H,24,25)/b8-5-,14-13+/t17-,18-,19-/m0/s1
