926664-32-6 Usage
General Description
The chemical "1-(1,3-benzodioxol-5-yl)-N-[5-[(S)-(2-chlorophenyl)[(3R)-3-hydroxy-1-pyrrolidinyl]methyl]-2-thiazolyl]-cyclopropanecarboxamide" is a complex compound with a molecular structure that includes a benzodioxol ring, a thiazolyl ring, and a cyclopropanecarboxamide group. It also contains an S-chlorophenyl and a 3R-hydroxy-1-pyrrolidinylmethyl group as substituents. This chemical is a potential drug candidate or biological reagent for research purposes, as it may have specific pharmacological or biochemical properties. The precise biological activity and therapeutic potential of this compound would require further investigation and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 926664-32-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,6,6,6 and 4 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 926664-32:
(8*9)+(7*2)+(6*6)+(5*6)+(4*6)+(3*4)+(2*3)+(1*2)=196
196 % 10 = 6
So 926664-32-6 is a valid CAS Registry Number.
InChI:InChI=1/C25H24ClN3O4S/c26-18-4-2-1-3-17(18)22(29-10-7-16(30)13-29)21-12-27-24(34-21)28-23(31)25(8-9-25)15-5-6-19-20(11-15)33-14-32-19/h1-6,11-12,16,22,30H,7-10,13-14H2,(H,27,28,31)/t16-,22+/m1/s1