927186-53-6 Usage
Description
2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]is a complex chemical compound with a 2-pyridinamine base and additional iodine, nitro, and ethoxy groups. The presence of these groupings gives the compound distinct properties, including a potentially high toxicity due to the presence of the nitro and iodine moieties. 2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]also consists of a 2-(4-nitrophenyl)ethoxy group, which may contribute to its potential applications in pharmaceutical or organic synthesis. Overall, the compound exhibits a complex structure with various functional groups, suggesting potential use in diverse applications within the chemical industry.
Uses
Used in Pharmaceutical Industry:
2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]is used as an intermediate in the synthesis of pharmaceutical compounds for various therapeutic applications. Its unique structure and functional groups make it a valuable building block in the development of new drugs.
Used in Organic Synthesis:
2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]is used as a reagent in organic synthesis for the preparation of various organic compounds. Its complex structure and functional groups allow for versatile reactions and the formation of a wide range of products.
Used in Chemical Research:
2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]is used as a research compound in chemical studies to investigate its properties, reactivity, and potential applications. Its unique structure and functional groups make it an interesting subject for scientific exploration and discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 927186-53-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,7,1,8 and 6 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 927186-53:
(8*9)+(7*2)+(6*7)+(5*1)+(4*8)+(3*6)+(2*5)+(1*3)=196
196 % 10 = 6
So 927186-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H11IN4O5/c14-10-7-11(18(21)22)12(15)16-13(10)23-6-5-8-1-3-9(4-2-8)17(19)20/h1-4,7H,5-6H2,(H2,15,16)
