93964-77-3 Usage
General Description
L-arginine L-malate is a chemical compound that combines two molecules: L-arginine, an amino acid involved in protein synthesis, and L-malate, a dicarboxylic acid involved in the citric acid cycle. L-arginine is known for its role in promoting vasodilation, or the widening of blood vessels, which can improve blood flow and circulation. It is also involved in the production of nitric oxide, a molecule that helps relax blood vessels and improve endothelial function. L-malate, on the other hand, is involved in energy production and can help improve exercise performance and reduce muscle fatigue. The combination of these two compounds in L-arginine L-malate may provide benefits for cardiovascular health, athletic performance, and energy production.
Check Digit Verification of cas no
The CAS Registry Mumber 93964-77-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,9,6 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 93964-77:
(7*9)+(6*3)+(5*9)+(4*6)+(3*4)+(2*7)+(1*7)=183
183 % 10 = 3
So 93964-77-3 is a valid CAS Registry Number.
InChI:InChI=1S/C6H14N4O2.C4H6O5/c7-4(5(11)12)2-1-3-10-6(8)9;5-2(4(8)9)1-3(6)7/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2,5H,1H2,(H,6,7)(H,8,9)/t4-;2-/m00/s1