944709-58-4 Usage
Description
Ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate is a chemical compound with the molecular formula C11H8BrNO3. It is a derivative of furo[2,3-b]pyridine and is known for its versatile reactivity and unique structure with functional groups. ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate is commonly used in the pharmaceutical industry for the synthesis of various biologically active compounds and serves as an important intermediate in the development of potential pharmaceuticals.
Uses
Used in Pharmaceutical Industry:
Ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate is used as a building block for the synthesis of various drugs and pharmaceutical compounds. Its unique structure and functional groups make it an important intermediate in the development of bioactive molecules.
Used in Drug Discovery and Development:
Ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate is used as a key component in the discovery and development of new pharmaceuticals. Its potential pharmacological properties and versatile reactivity contribute to the creation of innovative and effective drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 944709-58-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,4,4,7,0 and 9 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 944709-58:
(8*9)+(7*4)+(6*4)+(5*7)+(4*0)+(3*9)+(2*5)+(1*8)=204
204 % 10 = 4
So 944709-58-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H8BrNO3/c1-2-14-10(13)7-3-6-4-8(11)15-9(6)12-5-7/h3-5H,2H2,1H3